C30H42O4Si — CID 11329413
(2R,3R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-2-methylpentan-3-ol (PubChem CID 11329413) has the molecular formula C30H42O4Si and a molecular weight of 494.75 g/mol. Its IUPAC name is (2R,3R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-2-methylpentan-3-ol.
| Compound Name | (2R,3R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 11329413 |
| Molecular Formula | C30H42O4Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2R,3R)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-2-methylpentan-3-ol |
| SMILES | C[C@H](CC1CCC2(C=CCCO2)O1)[C@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42O4Si/c1-24(23-25-17-20-30(34-25)19-11-12-21-32-30)28(31)18-22-33-35(29(2,3)4,26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-11,13-16,19,24-25,28,31H,12,17-18,20-23H2,1-4H3/t24-,25?,28-,30?/m1/s1 |
| InChIKey | FOURLMSZAABJLY-YUEDQSTCSA-N |
| XLogP | 5.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|