C18H18IN5O4 — CID 11329418
(2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11329418) has the molecular formula C18H18IN5O4 and a molecular weight of 495.28 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11329418 |
| Molecular Formula | C18H18IN5O4 |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2,3-dihydroindol-1-yl)-8-iodopurin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2c(I)nc3c(N4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18IN5O4/c19-18-22-12-15(23-6-5-9-3-1-2-4-10(9)23)20-8-21-16(12)24(18)17-14(27)13(26)11(7-25)28-17/h1-4,8,11,13-14,17,25-27H,5-7H2/t11-,13-,14-,17-/m1/s1 |
| InChIKey | ZUDAGLBFGLQLHQ-LSCFUAHRSA-N |
| XLogP | 0.74 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|