C16H19ClN2 — CID 113294666
N-[[1-(chloromethyl)cyclopentyl]methyl]quinolin-2-amine (PubChem CID 113294666) has the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopentyl]methyl]quinolin-2-amine.
| Compound Name | N-[[1-(chloromethyl)cyclopentyl]methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 113294666 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopentyl]methyl]quinolin-2-amine |
| SMILES | ClCC1(CNc2ccc3ccccc3n2)CCCC1 |
| InChI | InChI=1S/C16H19ClN2/c17-11-16(9-3-4-10-16)12-18-15-8-7-13-5-1-2-6-14(13)19-15/h1-2,5-8H,3-4,9-12H2,(H,18,19) |
| InChIKey | CPQBUBDAKRGIMA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|