C14H18N2O — CID 113296320
1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3-diazinan-2-one (PubChem CID 113296320) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 113296320 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1C1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H18N2O/c17-14-15-8-3-9-16(14)13-7-6-11-4-1-2-5-12(11)10-13/h1-2,4-5,13H,3,6-10H2,(H,15,17) |
| InChIKey | OFKDTALBFROTAU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |