C10H11F3N4O — CID 113296719
N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 113296719) has the molecular formula C10H11F3N4O and a molecular weight of 260.22 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 113296719 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | FC(F)(F)COCCNc1ccn2nccc2n1 |
| InChI | InChI=1S/C10H11F3N4O/c11-10(12,13)7-18-6-4-14-8-2-5-17-9(16-8)1-3-15-17/h1-3,5H,4,6-7H2,(H,14,16) |
| InChIKey | LEHUZEKCBSHZHS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|