C31H46O4S — CID 11329744
4-[(E)-4-(4-hydroxyphenyl)-14-pentylsulfonyltetradec-3-en-3-yl]phenol (PubChem CID 11329744) has the molecular formula C31H46O4S and a molecular weight of 514.77 g/mol. Its IUPAC name is 4-[(E)-4-(4-hydroxyphenyl)-14-pentylsulfonyltetradec-3-en-3-yl]phenol.
| Compound Name | 4-[(E)-4-(4-hydroxyphenyl)-14-pentylsulfonyltetradec-3-en-3-yl]phenol |
|---|---|
| PubChem CID | 11329744 |
| Molecular Formula | C31H46O4S |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 4-[(E)-4-(4-hydroxyphenyl)-14-pentylsulfonyltetradec-3-en-3-yl]phenol |
| SMILES | CCCCCS(=O)(=O)CCCCCCCCCC/C(=C(/CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H46O4S/c1-3-5-13-24-36(34,35)25-14-11-9-7-6-8-10-12-15-31(27-18-22-29(33)23-19-27)30(4-2)26-16-20-28(32)21-17-26/h16-23,32-33H,3-15,24-25H2,1-2H3/b31-30+ |
| InChIKey | BKCUWMJZEGWQLM-NVQSTNCTSA-N |
| XLogP | 8.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|