C24H18F9N3 — CID 11329827
1,3,5-tris[2-(trifluoromethyl)phenyl]-1,3,5-triazinane (PubChem CID 11329827) has the molecular formula C24H18F9N3 and a molecular weight of 519.41 g/mol. Its IUPAC name is 1,3,5-tris[2-(trifluoromethyl)phenyl]-1,3,5-triazinane.
| Compound Name | 1,3,5-tris[2-(trifluoromethyl)phenyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 11329827 |
| Molecular Formula | C24H18F9N3 |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 1,3,5-tris[2-(trifluoromethyl)phenyl]-1,3,5-triazinane |
| SMILES | FC(F)(F)c1ccccc1N1CN(c2ccccc2C(F)(F)F)CN(c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C24H18F9N3/c25-22(26,27)16-7-1-4-10-19(16)34-13-35(20-11-5-2-8-17(20)23(28,29)30)15-36(14-34)21-12-6-3-9-18(21)24(31,32)33/h1-12H,13-15H2 |
| InChIKey | HWHGVCZYPGYIEK-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |