C14H20O2S2 — CID 113299385
2-(3-methoxyphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol (PubChem CID 113299385) has the molecular formula C14H20O2S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol.
| Compound Name | 2-(3-methoxyphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 113299385 |
| Molecular Formula | C14H20O2S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanol |
| SMILES | COc1cccc(CC(O)C2SCCSC2C)c1 |
| InChI | InChI=1S/C14H20O2S2/c1-10-14(18-7-6-17-10)13(15)9-11-4-3-5-12(8-11)16-2/h3-5,8,10,13-15H,6-7,9H2,1-2H3 |
| InChIKey | UNXKKKGXLRFXJT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |