C12H13Cl2N3 — CID 113301298
3-[(3,4-dichlorophenyl)methyl]-4-propyl-1,2,4-triazole (PubChem CID 113301298) has the molecular formula C12H13Cl2N3 and a molecular weight of 270.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-4-propyl-1,2,4-triazole.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 113301298 |
| Molecular Formula | C12H13Cl2N3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-4-propyl-1,2,4-triazole |
| SMILES | CCCn1cnnc1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N3/c1-2-5-17-8-15-16-12(17)7-9-3-4-10(13)11(14)6-9/h3-4,6,8H,2,5,7H2,1H3 |
| InChIKey | AJWDEQDRHOSYGD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |