C13H7ClF2N2 — CID 113303202
6-chloro-2-(3,5-difluorophenyl)imidazo[1,2-a]pyridine (PubChem CID 113303202) has the molecular formula C13H7ClF2N2 and a molecular weight of 264.66 g/mol. Its IUPAC name is 6-chloro-2-(3,5-difluorophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-2-(3,5-difluorophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 113303202 |
| Molecular Formula | C13H7ClF2N2 |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 6-chloro-2-(3,5-difluorophenyl)imidazo[1,2-a]pyridine |
| SMILES | Fc1cc(F)cc(-c2cn3cc(Cl)ccc3n2)c1 |
| InChI | InChI=1S/C13H7ClF2N2/c14-9-1-2-13-17-12(7-18(13)6-9)8-3-10(15)5-11(16)4-8/h1-7H |
| InChIKey | RVCZPZSJPSHZMJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |