C12H8BrN3S — CID 113303376
12-bromo-5-thia-10,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene (PubChem CID 113303376) has the molecular formula C12H8BrN3S and a molecular weight of 306.19 g/mol. Its IUPAC name is 12-bromo-5-thia-10,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene.
| Compound Name | 12-bromo-5-thia-10,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
|---|---|
| PubChem CID | 113303376 |
| Molecular Formula | C12H8BrN3S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 12-bromo-5-thia-10,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
| SMILES | Brc1cnc2nc3c(n2c1)CCc1sccc1-3 |
| InChI | InChI=1S/C12H8BrN3S/c13-7-5-14-12-15-11-8-3-4-17-10(8)2-1-9(11)16(12)6-7/h3-6H,1-2H2 |
| InChIKey | JARBKNBHZCXPMV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |