C12H15F2N3 — CID 113303573
N-[(1-ethylbenzimidazol-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 113303573) has the molecular formula C12H15F2N3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 113303573 |
| Molecular Formula | C12H15F2N3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | CCn1c(CNCC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C12H15F2N3/c1-2-17-10-6-4-3-5-9(10)16-12(17)8-15-7-11(13)14/h3-6,11,15H,2,7-8H2,1H3 |
| InChIKey | OPKWQQCWKIEXLE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |