C31H40N8O2 — CID 11330384
4-[[(4-tert-butylcyclohexyl)-(1-ethyl-6-prop-2-enoxybenzimidazol-2-yl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 11330384) has the molecular formula C31H40N8O2 and a molecular weight of 556.72 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-(1-ethyl-6-prop-2-enoxybenzimidazol-2-yl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-(1-ethyl-6-prop-2-enoxybenzimidazol-2-yl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 11330384 |
| Molecular Formula | C31H40N8O2 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-(1-ethyl-6-prop-2-enoxybenzimidazol-2-yl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | C=CCOc1ccc2nc(N(Cc3ccc(C(=O)Nc4nn[nH]n4)cc3)C3CCC(C(C)(C)C)CC3)n(CC)c2c1 |
| InChI | InChI=1S/C31H40N8O2/c1-6-18-41-25-16-17-26-27(19-25)38(7-2)30(32-26)39(24-14-12-23(13-15-24)31(3,4)5)20-21-8-10-22(11-9-21)28(40)33-29-34-36-37-35-29/h6,8-11,16-17,19,23-24H,1,7,12-15,18,20H2,2-5H3,(H2,33,34,35,36,37,40) |
| InChIKey | WNXFLRCVQYOJSO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|