About 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid
1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid (PubChem CID 113303920) has the molecular formula C11H18F2N2O3
and a molecular weight of 264.27 g/mol. Its IUPAC name is 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid |
| PubChem CID | 113303920 |
| Molecular Formula | C11H18F2N2O3 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid |
| SMILES | O=C(NCC(F)F)NC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C11H18F2N2O3/c12-8(13)7-14-10(18)15-11(9(16)17)5-3-1-2-4-6-11/h8H,1-7H2,(H,16,17)(H2,14,15,18) |
| InChIKey | LHCFXPHXCCVZSY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid?
The IUPAC name of 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid (CID 113303920) is 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid.
What is the SMILES notation for 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid?
The canonical SMILES for 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid is O=C(NCC(F)F)NC1(C(=O)O)CCCCCC1.
What is the InChIKey of 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid?
The InChIKey is LHCFXPHXCCVZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2O3/c12-8(13)7-14-10(18)15-11(9(16)17)5-3-1-2-4-6-11/h8H,1-7H2,(H,16,17)(H2,14,15,18).
What are the key properties of 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid?
1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid has a molecular weight of 264.27 g/mol, XLogP of 1.73, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethylcarbamoylamino)cycloheptane-1-carboxylic acid is sourced from PubChem (CID 113303920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).