C9H8ClF2N5 — CID 113304028
4-chloro-3-[1-(2,2-difluoroethyl)tetrazol-5-yl]aniline (PubChem CID 113304028) has the molecular formula C9H8ClF2N5 and a molecular weight of 259.65 g/mol. Its IUPAC name is 4-chloro-3-[1-(2,2-difluoroethyl)tetrazol-5-yl]aniline.
| Compound Name | 4-chloro-3-[1-(2,2-difluoroethyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 113304028 |
| Molecular Formula | C9H8ClF2N5 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-chloro-3-[1-(2,2-difluoroethyl)tetrazol-5-yl]aniline |
| SMILES | Nc1ccc(Cl)c(-c2nnnn2CC(F)F)c1 |
| InChI | InChI=1S/C9H8ClF2N5/c10-7-2-1-5(13)3-6(7)9-14-15-16-17(9)4-8(11)12/h1-3,8H,4,13H2 |
| InChIKey | NCZJOLQVIQEGGY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|