About 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile
4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile (PubChem CID 113305656) has the molecular formula C13H10FN3O
and a molecular weight of 243.24 g/mol. Its IUPAC name is 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 113305656 |
| Molecular Formula | C13H10FN3O |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1cc(F)ncn1 |
| InChI | InChI=1S/C13H10FN3O/c1-8-3-10(6-15)4-9(2)13(8)18-12-5-11(14)16-7-17-12/h3-5,7H,1-2H3 |
| InChIKey | SFFXRCWDQJWPCH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile (CID 113305656) is 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Oc1cc(F)ncn1.
What is the InChIKey of 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile?
The InChIKey is SFFXRCWDQJWPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3O/c1-8-3-10(6-15)4-9(2)13(8)18-12-5-11(14)16-7-17-12/h3-5,7H,1-2H3.
What are the key properties of 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile?
4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile has a molecular weight of 243.24 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoropyrimidin-4-yl)oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 113305656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).