C11H8F3N3O — CID 113305662
N-[2-(difluoromethoxy)phenyl]-6-fluoropyrimidin-4-amine (PubChem CID 113305662) has the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-6-fluoropyrimidin-4-amine.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-6-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 113305662 |
| Molecular Formula | C11H8F3N3O |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-6-fluoropyrimidin-4-amine |
| SMILES | Fc1cc(Nc2ccccc2OC(F)F)ncn1 |
| InChI | InChI=1S/C11H8F3N3O/c12-9-5-10(16-6-15-9)17-7-3-1-2-4-8(7)18-11(13)14/h1-6,11H,(H,15,16,17) |
| InChIKey | QSSXYNWMTLQCFD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |