C13H17NO2S — CID 113306137
6-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4,4-dioxide (PubChem CID 113306137) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4,4-dioxide.
| Compound Name | 6-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4,4-dioxide |
|---|---|
| PubChem CID | 113306137 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4,4-dioxide |
| SMILES | CC1CC2C(NCCS2(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C13H17NO2S/c1-9-8-12-13(14-6-7-17(12,15)16)11-5-3-2-4-10(9)11/h2-5,9,12-14H,6-8H2,1H3 |
| InChIKey | IZVBHCRTFWYFHZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |