C15H17NO2 — CID 113306146
3-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2,5-dione (PubChem CID 113306146) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 113306146 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolidine-2,5-dione |
| SMILES | CC1CCC(C2CC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H17NO2/c1-9-6-7-12(11-5-3-2-4-10(9)11)13-8-14(17)16-15(13)18/h2-5,9,12-13H,6-8H2,1H3,(H,16,17,18) |
| InChIKey | ZGXHXBTUNDHWOH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|