C11H8F2N2O2S — CID 113306662
2-(3,5-difluoroanilino)-5-methyl-1,3-thiazole-4-carboxylic acid (PubChem CID 113306662) has the molecular formula C11H8F2N2O2S and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-(3,5-difluoroanilino)-5-methyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(3,5-difluoroanilino)-5-methyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113306662 |
| Molecular Formula | C11H8F2N2O2S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-(3,5-difluoroanilino)-5-methyl-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1sc(Nc2cc(F)cc(F)c2)nc1C(=O)O |
| InChI | InChI=1S/C11H8F2N2O2S/c1-5-9(10(16)17)15-11(18-5)14-8-3-6(12)2-7(13)4-8/h2-4H,1H3,(H,14,15)(H,16,17) |
| InChIKey | YKZOJIVMCULNAJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |