About 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid
5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 113306891) has the molecular formula C10H14N2O4S2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 113306891 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1sc(NC2(C)CCS(=O)(=O)C2)nc1C(=O)O |
| InChI | InChI=1S/C10H14N2O4S2/c1-6-7(8(13)14)11-9(17-6)12-10(2)3-4-18(15,16)5-10/h3-5H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | KXGNIQGOCGLPTG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid (CID 113306891) is 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid is Cc1sc(NC2(C)CCS(=O)(=O)C2)nc1C(=O)O.
What is the InChIKey of 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is KXGNIQGOCGLPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4S2/c1-6-7(8(13)14)11-9(17-6)12-10(2)3-4-18(15,16)5-10/h3-5H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid?
5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 290.37 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 113306891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).