C32H46O6SSi — CID 11330738
methyl (2S,3S,4R,5R,6R)-4-phenylmethoxy-6-phenylsulfanyl-5-prop-2-enoxy-3-tri(propan-2-yl)silyloxyoxane-2-carboxylate (PubChem CID 11330738) has the molecular formula C32H46O6SSi and a molecular weight of 586.87 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6R)-4-phenylmethoxy-6-phenylsulfanyl-5-prop-2-enoxy-3-tri(propan-2-yl)silyloxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6R)-4-phenylmethoxy-6-phenylsulfanyl-5-prop-2-enoxy-3-tri(propan-2-yl)silyloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11330738 |
| Molecular Formula | C32H46O6SSi |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | methyl (2S,3S,4R,5R,6R)-4-phenylmethoxy-6-phenylsulfanyl-5-prop-2-enoxy-3-tri(propan-2-yl)silyloxyoxane-2-carboxylate |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C(=O)OC)O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C32H46O6SSi/c1-9-20-35-30-27(36-21-25-16-12-10-13-17-25)28(38-40(22(2)3,23(4)5)24(6)7)29(31(33)34-8)37-32(30)39-26-18-14-11-15-19-26/h9-19,22-24,27-30,32H,1,20-21H2,2-8H3/t27-,28-,29-,30+,32+/m0/s1 |
| InChIKey | KABFNLJUYXZJOS-SIKAAIQYSA-N |
| XLogP | 7.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|