C10H10F3N3O2 — CID 113307418
6-amino-5-(3,3,3-trifluoropropylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 113307418) has the molecular formula C10H10F3N3O2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 6-amino-5-(3,3,3-trifluoropropylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(3,3,3-trifluoropropylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 113307418 |
| Molecular Formula | C10H10F3N3O2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 6-amino-5-(3,3,3-trifluoropropylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1NCCC(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O2/c11-10(12,13)1-2-15-6-4-7-8(3-5(6)14)18-9(17)16-7/h3-4,15H,1-2,14H2,(H,16,17) |
| InChIKey | RMJHZRYAQAAXHX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|