C12H16N2O3 — CID 113307460
6-amino-5-(3-methylbutoxy)-3H-1,3-benzoxazol-2-one (PubChem CID 113307460) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-amino-5-(3-methylbutoxy)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(3-methylbutoxy)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 113307460 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 6-amino-5-(3-methylbutoxy)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)CCOc1cc2[nH]c(=O)oc2cc1N |
| InChI | InChI=1S/C12H16N2O3/c1-7(2)3-4-16-10-6-9-11(5-8(10)13)17-12(15)14-9/h5-7H,3-4,13H2,1-2H3,(H,14,15) |
| InChIKey | BEXOXRVKKAMJEO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|