C12H13FN4O2 — CID 113308371
3-[5-(3-fluorophenyl)tetrazol-1-yl]-2,2-dimethylpropanoic acid (PubChem CID 113308371) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is 3-[5-(3-fluorophenyl)tetrazol-1-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[5-(3-fluorophenyl)tetrazol-1-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 113308371 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[5-(3-fluorophenyl)tetrazol-1-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cn1nnnc1-c1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C12H13FN4O2/c1-12(2,11(18)19)7-17-10(14-15-16-17)8-4-3-5-9(13)6-8/h3-6H,7H2,1-2H3,(H,18,19) |
| InChIKey | PMCKQATUULMVBA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |