C32H40O9S — CID 11330873
tert-butyl 2-[(2S,9S,12R,13R,15S)-15-ethylsulfanylcarbonyl-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate (PubChem CID 11330873) has the molecular formula C32H40O9S and a molecular weight of 600.73 g/mol. Its IUPAC name is tert-butyl 2-[(2S,9S,12R,13R,15S)-15-ethylsulfanylcarbonyl-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,9S,12R,13R,15S)-15-ethylsulfanylcarbonyl-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate |
|---|---|
| PubChem CID | 11330873 |
| Molecular Formula | C32H40O9S |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | tert-butyl 2-[(2S,9S,12R,13R,15S)-15-ethylsulfanylcarbonyl-12-[(E)-oct-6-enyl]-4,6,18-trioxo-5,16,17-trioxapentacyclo[7.7.2.01,10.02,13.03,7]octadeca-3(7),10-dien-9-yl]acetate |
| SMILES | C/C=C/CCCCC[C@H]1C=C2C34OC(=O)[C@]2(CC(=O)OC(C)(C)C)CC2=C(C(=O)OC2=O)[C@@H]3[C@@H]1C[C@@H](C(=O)SCC)O4 |
| InChI | InChI=1S/C32H40O9S/c1-6-8-9-10-11-12-13-18-14-22-31(17-23(33)40-30(3,4)5)16-20-24(27(35)38-26(20)34)25-19(18)15-21(28(36)42-7-2)39-32(22,25)41-29(31)37/h6,8,14,18-19,21,25H,7,9-13,15-17H2,1-5H3/b8-6+/t18-,19+,21-,25-,31-,32?/m0/s1 |
| InChIKey | MTWVHGPQSDQQFA-QPTIBNODSA-N |
| XLogP | 5.13 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|