C13H17FN2O — CID 113308842
3,3-diethyl-7-fluoro-4,5-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 113308842) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 3,3-diethyl-7-fluoro-4,5-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | 3,3-diethyl-7-fluoro-4,5-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 113308842 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3,3-diethyl-7-fluoro-4,5-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | CCC1(CC)CNc2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C13H17FN2O/c1-3-13(4-2)8-15-11-7-9(14)5-6-10(11)16-12(13)17/h5-7,15H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | REXMKRSXMBXXRX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |