C12H16N2O4S — CID 113309102
1-[(pyridin-3-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid (PubChem CID 113309102) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[(pyridin-3-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(pyridin-3-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 113309102 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[(pyridin-3-ylsulfonylamino)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNS(=O)(=O)c2cccnc2)CCCC1 |
| InChI | InChI=1S/C12H16N2O4S/c15-11(16)12(5-1-2-6-12)9-14-19(17,18)10-4-3-7-13-8-10/h3-4,7-8,14H,1-2,5-6,9H2,(H,15,16) |
| InChIKey | KLDXLFMSRHAQRU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |