C13H24N2O3 — CID 113309229
1-[(2-aminohexanoylamino)methyl]cyclopentane-1-carboxylic acid (PubChem CID 113309229) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[(2-aminohexanoylamino)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(2-aminohexanoylamino)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 113309229 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[(2-aminohexanoylamino)methyl]cyclopentane-1-carboxylic acid |
| SMILES | CCCCC(N)C(=O)NCC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C13H24N2O3/c1-2-3-6-10(14)11(16)15-9-13(12(17)18)7-4-5-8-13/h10H,2-9,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | YHGJYDXTOMAPEP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |