C35H42N6O3S — CID 11331068
N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-[2-methyl-2-(3-methylphenyl)propyl]-3-phenylpropanamide (PubChem CID 11331068) has the molecular formula C35H42N6O3S and a molecular weight of 626.83 g/mol. Its IUPAC name is N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-[2-methyl-2-(3-methylphenyl)propyl]-3-phenylpropanamide.
| Compound Name | N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-[2-methyl-2-(3-methylphenyl)propyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 11331068 |
| Molecular Formula | C35H42N6O3S |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | N-[2-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]-N-[2-methyl-2-(3-methylphenyl)propyl]-3-phenylpropanamide |
| SMILES | Cc1cccc(C(C)(C)CN(CC(=O)N[C@@H](CCCN=C(N)N)C(=O)c2nc3ccccc3s2)C(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C35H42N6O3S/c1-24-11-9-14-26(21-24)35(2,3)23-41(31(43)19-18-25-12-5-4-6-13-25)22-30(42)39-28(16-10-20-38-34(36)37)32(44)33-40-27-15-7-8-17-29(27)45-33/h4-9,11-15,17,21,28H,10,16,18-20,22-23H2,1-3H3,(H,39,42)(H4,36,37,38)/t28-/m0/s1 |
| InChIKey | URLAUDJYECFULL-NDEPHWFRSA-N |
| XLogP | 4.77 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|