C30H40Cl3NO5Si — CID 11331089
2,2,2-trichloroethyl N-[(E,1S)-1-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enyl]carbamate (PubChem CID 11331089) has the molecular formula C30H40Cl3NO5Si and a molecular weight of 629.10 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(E,1S)-1-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(E,1S)-1-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enyl]carbamate |
|---|---|
| PubChem CID | 11331089 |
| Molecular Formula | C30H40Cl3NO5Si |
| Molecular Weight | 629.10 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(E,1S)-1-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-enyl]carbamate |
| SMILES | CC/C=C/[C@H](NC(=O)OCC(Cl)(Cl)Cl)[C@H]1OC(C)(C)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H40Cl3NO5Si/c1-7-8-19-24(34-27(35)36-21-30(31,32)33)26-25(38-29(5,6)39-26)20-37-40(28(2,3)4,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h8-19,24-26H,7,20-21H2,1-6H3,(H,34,35)/b19-8+/t24-,25+,26+/m0/s1 |
| InChIKey | OUVXYTBCDLGLIY-QHTGJCAWSA-N |
| XLogP | 6.51 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.10 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|