C12H20N2O4 — CID 113311291
1-[[(2-methylmorpholine-4-carbonyl)amino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 113311291) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-[[(2-methylmorpholine-4-carbonyl)amino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[(2-methylmorpholine-4-carbonyl)amino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 113311291 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[[(2-methylmorpholine-4-carbonyl)amino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | CC1CN(C(=O)NCC2(C(=O)O)CCC2)CCO1 |
| InChI | InChI=1S/C12H20N2O4/c1-9-7-14(5-6-18-9)11(17)13-8-12(10(15)16)3-2-4-12/h9H,2-8H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | HQXFXRCPSXARAD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |