C11H18N2O5 — CID 113311657
(2S)-2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]pentanedioic acid (PubChem CID 113311657) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2S)-2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 113311657 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2S)-2-[[1-(aminomethyl)cyclobutanecarbonyl]amino]pentanedioic acid |
| SMILES | NCC1(C(=O)N[C@@H](CCC(=O)O)C(=O)O)CCC1 |
| InChI | InChI=1S/C11H18N2O5/c12-6-11(4-1-5-11)10(18)13-7(9(16)17)2-3-8(14)15/h7H,1-6,12H2,(H,13,18)(H,14,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | SFTLPVSKGBOXHK-ZETCQYMHSA-N |
| XLogP | -0.45 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |