C13H24N2O3 — CID 113312630
1-[(5-methylhexylcarbamoylamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 113312630) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[(5-methylhexylcarbamoylamino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(5-methylhexylcarbamoylamino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 113312630 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[(5-methylhexylcarbamoylamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)CCCCNC(=O)NCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-10(2)5-3-4-8-14-12(18)15-9-13(6-7-13)11(16)17/h10H,3-9H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | JEBFYJNAMJVMCW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|