C12H15F3N2 — CID 113313720
N-[[1-(aminomethyl)cyclopropyl]methyl]-4-(trifluoromethyl)aniline (PubChem CID 113313720) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclopropyl]methyl]-4-(trifluoromethyl)aniline.
| Compound Name | N-[[1-(aminomethyl)cyclopropyl]methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 113313720 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[[1-(aminomethyl)cyclopropyl]methyl]-4-(trifluoromethyl)aniline |
| SMILES | NCC1(CNc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C12H15F3N2/c13-12(14,15)9-1-3-10(4-2-9)17-8-11(7-16)5-6-11/h1-4,17H,5-8,16H2 |
| InChIKey | NTXVNOSHIAFHTH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |