C41H45O5PS — CID 11331377
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 11331377) has the molecular formula C41H45O5PS and a molecular weight of 680.85 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 11331377 |
| Molecular Formula | C41H45O5PS |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-oxo-2-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | CC(C)CC(=O)C(C(=O)O[C@H]1C[C@@H]2CC[C@@]1(CS(=O)(=O)c1ccccc1)C2(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H45O5PS/c1-30(2)27-36(42)38(47(32-17-9-5-10-18-32,33-19-11-6-12-20-33)34-21-13-7-14-22-34)39(43)46-37-28-31-25-26-41(37,40(31,3)4)29-48(44,45)35-23-15-8-16-24-35/h5-24,30-31,37H,25-29H2,1-4H3/t31-,37-,41-/m0/s1 |
| InChIKey | HYSGFOSEQPSFAO-XCGKAFCQSA-N |
| XLogP | 6.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|