C10H15N7O — CID 113314181
2-[4-(aminomethyl)triazol-1-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide (PubChem CID 113314181) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 113314181 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[(1-methylimidazol-2-yl)methyl]acetamide |
| SMILES | Cn1ccnc1CNC(=O)Cn1cc(CN)nn1 |
| InChI | InChI=1S/C10H15N7O/c1-16-3-2-12-9(16)5-13-10(18)7-17-6-8(4-11)14-15-17/h2-3,6H,4-5,7,11H2,1H3,(H,13,18) |
| InChIKey | FVSDPPSVXHNFQN-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |