C13H25N3O2 — CID 113314985
N-[1-[(2S,3S)-2-amino-3-methylpentanoyl]piperidin-4-yl]acetamide (PubChem CID 113314985) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[1-[(2S,3S)-2-amino-3-methylpentanoyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[(2S,3S)-2-amino-3-methylpentanoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 113314985 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-[1-[(2S,3S)-2-amino-3-methylpentanoyl]piperidin-4-yl]acetamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N1CCC(NC(C)=O)CC1 |
| InChI | InChI=1S/C13H25N3O2/c1-4-9(2)12(14)13(18)16-7-5-11(6-8-16)15-10(3)17/h9,11-12H,4-8,14H2,1-3H3,(H,15,17)/t9-,12-/m0/s1 |
| InChIKey | JBPLYULLEQAWMM-CABZTGNLSA-N |
| XLogP | 0.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |