C14H12N2O — CID 113315472
12-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene (PubChem CID 113315472) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 12-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene.
| Compound Name | 12-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
|---|---|
| PubChem CID | 113315472 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 12-methyl-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
| SMILES | Cc1ccc2nc3c(n2c1)CCc1occc1-3 |
| InChI | InChI=1S/C14H12N2O/c1-9-2-5-13-15-14-10-6-7-17-12(10)4-3-11(14)16(13)8-9/h2,5-8H,3-4H2,1H3 |
| InChIKey | NQQAGJZFMMOWNC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |