C14H12N2O2 — CID 113315478
14-methoxy-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene (PubChem CID 113315478) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 14-methoxy-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene.
| Compound Name | 14-methoxy-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
|---|---|
| PubChem CID | 113315478 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 14-methoxy-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
| SMILES | COc1cccn2c3c(nc12)-c1ccoc1CC3 |
| InChI | InChI=1S/C14H12N2O2/c1-17-12-3-2-7-16-10-4-5-11-9(6-8-18-11)13(10)15-14(12)16/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | RVMXXHRJCVXSNQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |