About 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile
4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 113315498) has the molecular formula C10H3BrF3N3OS
and a molecular weight of 350.12 g/mol. Its IUPAC name is 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile |
| PubChem CID | 113315498 |
| Molecular Formula | C10H3BrF3N3OS |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2nnc(Br)s2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H3BrF3N3OS/c11-8-16-17-9(19-8)18-7-2-1-5(4-15)3-6(7)10(12,13)14/h1-3H |
| InChIKey | ITHHZODXNXHABD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile?
The IUPAC name of 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile (CID 113315498) is 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile is N#Cc1ccc(Oc2nnc(Br)s2)c(C(F)(F)F)c1.
What is the InChIKey of 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile?
The InChIKey is ITHHZODXNXHABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3BrF3N3OS/c11-8-16-17-9(19-8)18-7-2-1-5(4-15)3-6(7)10(12,13)14/h1-3H.
What are the key properties of 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile?
4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile has a molecular weight of 350.12 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-bromo-1,3,4-thiadiazol-2-yl)oxy]-3-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 113315498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).