C46H54N4O4 — CID 11331580
2-[3-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-(3-phenylpropyl)amino]hexyl-(3-phenylpropyl)amino]propyl]isoindole-1,3-dione (PubChem CID 11331580) has the molecular formula C46H54N4O4 and a molecular weight of 726.96 g/mol. Its IUPAC name is 2-[3-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-(3-phenylpropyl)amino]hexyl-(3-phenylpropyl)amino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-(3-phenylpropyl)amino]hexyl-(3-phenylpropyl)amino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11331580 |
| Molecular Formula | C46H54N4O4 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.41 |
| IUPAC Name | 2-[3-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-(3-phenylpropyl)amino]hexyl-(3-phenylpropyl)amino]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCN(CCCCCCN(CCCc1ccccc1)CCCN1C(=O)c2ccccc2C1=O)CCCc1ccccc1 |
| InChI | InChI=1S/C46H54N4O4/c51-43-39-25-9-10-26-40(39)44(52)49(43)35-17-33-47(31-15-23-37-19-5-3-6-20-37)29-13-1-2-14-30-48(32-16-24-38-21-7-4-8-22-38)34-18-36-50-45(53)41-27-11-12-28-42(41)46(50)54/h3-12,19-22,25-28H,1-2,13-18,23-24,29-36H2 |
| InChIKey | ANHMENQCYCAXKB-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|