C11H14ClN3O2 — CID 113316435
N-(5-chloro-2-nitrophenyl)-1-cyclopropylethane-1,2-diamine (PubChem CID 113316435) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-1-cyclopropylethane-1,2-diamine.
| Compound Name | N-(5-chloro-2-nitrophenyl)-1-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 113316435 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-1-cyclopropylethane-1,2-diamine |
| SMILES | NCC(Nc1cc(Cl)ccc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C11H14ClN3O2/c12-8-3-4-11(15(16)17)9(5-8)14-10(6-13)7-1-2-7/h3-5,7,10,14H,1-2,6,13H2 |
| InChIKey | NWIWWDYCQYMWJM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|