About 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one
3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 113317701) has the molecular formula C11H20N2O3S
and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one |
| PubChem CID | 113317701 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | COCCNCC(O)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C11H20N2O3S/c1-8-9(2)17-11(15)13(8)7-10(14)6-12-4-5-16-3/h10,12,14H,4-7H2,1-3H3 |
| InChIKey | SUZGCZQIEHUCPF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one?
The IUPAC name of 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one (CID 113317701) is 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one?
The canonical SMILES for 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one is COCCNCC(O)Cn1c(C)c(C)sc1=O.
What is the InChIKey of 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one?
The InChIKey is SUZGCZQIEHUCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3S/c1-8-9(2)17-11(15)13(8)7-10(14)6-12-4-5-16-3/h10,12,14H,4-7H2,1-3H3.
What are the key properties of 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one?
3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one has a molecular weight of 260.36 g/mol, XLogP of 0.12, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-4,5-dimethyl-1,3-thiazol-2-one is sourced from PubChem (CID 113317701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).