About 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane
2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane (PubChem CID 113318152) has the molecular formula C11H26N2O3S
and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane.
Molecular Properties
| Compound Name | 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane |
| PubChem CID | 113318152 |
| Molecular Formula | C11H26N2O3S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane |
| SMILES | CC(C)N(C)S(=O)(=O)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C11H26N2O3S/c1-9(2)13(6)17(15,16)12-8-10(14)7-11(3,4)5/h9-10,12,14H,7-8H2,1-6H3 |
| InChIKey | LMBSJOBAKBWYBU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
The IUPAC name of 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane (CID 113318152) is 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane.
What is the SMILES notation for 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
The canonical SMILES for 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane is CC(C)N(C)S(=O)(=O)NCC(O)CC(C)(C)C.
What is the InChIKey of 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
The InChIKey is LMBSJOBAKBWYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O3S/c1-9(2)13(6)17(15,16)12-8-10(14)7-11(3,4)5/h9-10,12,14H,7-8H2,1-6H3.
What are the key properties of 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane has a molecular weight of 266.41 g/mol, XLogP of 0.96, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,4-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane is sourced from PubChem (CID 113318152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).