C41H62N8O9 — CID 11331839
tritert-butyl 10-[2-(10-butyl-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 11331839) has the molecular formula C41H62N8O9 and a molecular weight of 810.99 g/mol. Its IUPAC name is tritert-butyl 10-[2-(10-butyl-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-[2-(10-butyl-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 11331839 |
| Molecular Formula | C41H62N8O9 |
| Molecular Weight | 810.99 g/mol |
| Exact Mass | 810.46 |
| IUPAC Name | tritert-butyl 10-[2-(10-butyl-7,8-dimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CCCCn1c2nc(=O)n(CC(=O)N3CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC3)c(=O)c-2nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C41H62N8O9/c1-13-14-15-48-30-25-28(3)27(2)24-29(30)42-32-33(48)43-35(52)49(34(32)51)26-31(50)44-16-18-45(36(53)56-39(4,5)6)20-22-47(38(55)58-41(10,11)12)23-21-46(19-17-44)37(54)57-40(7,8)9/h24-25H,13-23,26H2,1-12H3 |
| InChIKey | WUJWNZUOKLSDHZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 178.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.99 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|