C10H14F2N2O3S — CID 113318779
N-(3,3-difluoro-2-hydroxypropyl)-2-pyridin-4-ylethanesulfonamide (PubChem CID 113318779) has the molecular formula C10H14F2N2O3S and a molecular weight of 280.30 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2-pyridin-4-ylethanesulfonamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2-pyridin-4-ylethanesulfonamide |
|---|---|
| PubChem CID | 113318779 |
| Molecular Formula | C10H14F2N2O3S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2-pyridin-4-ylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccncc1)NCC(O)C(F)F |
| InChI | InChI=1S/C10H14F2N2O3S/c11-10(12)9(15)7-14-18(16,17)6-3-8-1-4-13-5-2-8/h1-2,4-5,9-10,14-15H,3,6-7H2 |
| InChIKey | NDJIPSUHUWJOQT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |