5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid

C14H12ClNO2 — CID 113319492

IUPAC5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid
SMILESCc1cc(Cl)c(-c2cncc(C(=O)O)c2)cc1C
InChIInChI=1S/C14H12ClNO2/c1-8-3-12(13(15)4-9(8)2)10-5-11(14(17)18)7-16-6-10/h3-7H,1-2H3,(H,17,18)
InChIKeyKEUVQWQLYFYIOD-UHFFFAOYSA-N
MW261.71 g/mol
LogP3.72
Rot. Bonds2

About 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid

5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid (PubChem CID 113319492) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid
PubChem CID113319492
Molecular FormulaC14H12ClNO2
Molecular Weight261.71 g/mol
Exact Mass261.06
IUPAC Name5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid
SMILESCc1cc(Cl)c(-c2cncc(C(=O)O)c2)cc1C
InChIInChI=1S/C14H12ClNO2/c1-8-3-12(13(15)4-9(8)2)10-5-11(14(17)18)7-16-6-10/h3-7H,1-2H3,(H,17,18)
InChIKeyKEUVQWQLYFYIOD-UHFFFAOYSA-N
XLogP3.72
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.71
LogP ≤ 53.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid?
The IUPAC name of 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid (CID 113319492) is 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid?
The canonical SMILES for 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid is Cc1cc(Cl)c(-c2cncc(C(=O)O)c2)cc1C.
What is the InChIKey of 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid?
The InChIKey is KEUVQWQLYFYIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO2/c1-8-3-12(13(15)4-9(8)2)10-5-11(14(17)18)7-16-6-10/h3-7H,1-2H3,(H,17,18).
What are the key properties of 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid?
5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid has a molecular weight of 261.71 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 113319492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).