C14H12ClNO2 — CID 113319492
5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid (PubChem CID 113319492) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 113319492 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-(2-chloro-4,5-dimethylphenyl)pyridine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)c(-c2cncc(C(=O)O)c2)cc1C |
| InChI | InChI=1S/C14H12ClNO2/c1-8-3-12(13(15)4-9(8)2)10-5-11(14(17)18)7-16-6-10/h3-7H,1-2H3,(H,17,18) |
| InChIKey | KEUVQWQLYFYIOD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |