About N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide
N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide (PubChem CID 113320203) has the molecular formula C8H12F3N3O2S
and a molecular weight of 271.26 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 113320203 |
| Molecular Formula | C8H12F3N3O2S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCCCC(F)(F)F)c1cn[nH]c1 |
| InChI | InChI=1S/C8H12F3N3O2S/c9-8(10,11)3-1-2-4-14-17(15,16)7-5-12-13-6-7/h5-6,14H,1-4H2,(H,12,13) |
| InChIKey | JNQHHFNDMMUAEP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide (CID 113320203) is N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide is O=S(=O)(NCCCCC(F)(F)F)c1cn[nH]c1.
What is the InChIKey of N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide?
The InChIKey is JNQHHFNDMMUAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3O2S/c9-8(10,11)3-1-2-4-14-17(15,16)7-5-12-13-6-7/h5-6,14H,1-4H2,(H,12,13).
What are the key properties of N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide?
N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide has a molecular weight of 271.26 g/mol, XLogP of 1.42, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 113320203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).