C44H40ClF6N2P3Ru — CID 11332063
chlororuthenium(1+);1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine;hexafluorophosphate (PubChem CID 11332063) has the molecular formula C44H40ClF6N2P3Ru and a molecular weight of 940.25 g/mol. Its IUPAC name is chlororuthenium(1+);1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine;hexafluorophosphate.
| Compound Name | chlororuthenium(1+);1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine;hexafluorophosphate |
|---|---|
| PubChem CID | 11332063 |
| Molecular Formula | C44H40ClF6N2P3Ru |
| Molecular Weight | 940.25 g/mol |
| Exact Mass | 940.10 |
| IUPAC Name | chlororuthenium(1+);1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine;hexafluorophosphate |
| SMILES | C(=N\[C@H]1CCCC[C@@H]1/N=C/c1ccccc1P(c1ccccc1)c1ccccc1)\c1ccccc1P(c1ccccc1)c1ccccc1.Cl[Ru+].F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C44H40N2P2.ClH.F6P.Ru/c1-5-21-37(22-6-1)47(38-23-7-2-8-24-38)43-31-17-13-19-35(43)33-45-41-29-15-16-30-42(41)46-34-36-20-14-18-32-44(36)48(39-25-9-3-10-26-39)40-27-11-4-12-28-40;;1-7(2,3,4,5)6;/h1-14,17-28,31-34,41-42H,15-16,29-30H2;1H;;/q;;-1;+2/p-1/b45-33-,46-34+;;;/t41-,42-;;;/m0.../s1 |
| InChIKey | XITJTXAMLPAENF-KEPOJOGLSA-M |
| XLogP | 12.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.25 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|